CAS 473-30-3 appears in our catalog under these names: Thiazolesulfone, Thiazolsulfone. Offered by: TRC, Mikromol, LoGiCal. Available pack sizes: 100mg, 10mg.
5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine (CAS 473-30-3) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine. InChIKey: KVEZIRCKNOTGKY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 5-(4-aminophenyl)sulfonyl-1,3-thiazol-2-amine |
| InChIKey | KVEZIRCKNOTGKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CN=C(S2)N |
Computed by PubChem (NCBI)