CAS 892874-27-0 is the registry number for (3-Thiophen-2-ylmethyl-5-thioxo-1,5-dihydro-[1,2,4]triazol-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[5-sulfanylidene-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-4-yl]acetic acid (CAS 892874-27-0) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 2-[5-sulfanylidene-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-4-yl]acetic acid. InChIKey: YOFNIMYLKPTYCU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 2-[5-sulfanylidene-3-(thiophen-2-ylmethyl)-1H-1,2,4-triazol-4-yl]acetic acid |
| InChIKey | YOFNIMYLKPTYCU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC2=NNC(=S)N2CC(=O)O |
Computed by PubChem (NCBI)