CAS 1196157-72-8 appears in our catalog under these names: Sulfathiazole 13C6 (phenyl 13C6), Sulfathiazole-13C6, SULFATHIAZOL-13C6, 13C6-Sulfathiazole, Concentration: 100 µg/ml Solvent: Methanol, 13C6-Sulfathiazole. Offered by: Dr. Ehrenstorfer, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 25mg, 1x1ml, 1x10mg.
4-amino-N-(1,3-thiazol-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (CAS 1196157-72-8) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 261.3 g/mol. IUPAC name: 4-amino-N-(1,3-thiazol-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide. InChIKey: JNMRHUJNCSQMMB-UQUYMPKGSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 4-amino-N-(1,3-thiazol-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChIKey | JNMRHUJNCSQMMB-UQUYMPKGSA-N |
| SMILES | C1=CSC(=N1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N |
Computed by PubChem (NCBI)