CAS 75304-17-5 is the registry number for 2-Amino-N-(thiazol-2-yl)benzenesulfonamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide (CAS 75304-17-5) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 2-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: MJGGWXSWTHWCFW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 2-amino-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | MJGGWXSWTHWCFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)NC2=NC=CS2 |
Computed by PubChem (NCBI)