CAS 854137-70-5 appears in our catalog under these names: 3-(3-Sulfanyl-5-(thiophen-2-yl)-4H-1,2,4-triazol-4-yl)propanoic acid, 95%, 3-(3-Sulfanyl-5-(thiophen-2-yl)-4H-1,2,4-triazol-4-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid (CAS 854137-70-5) is a chemical compound with the molecular formula C9H9N3O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid. InChIKey: LDVAKKHSVPWPLE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 3-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanoic acid |
| InChIKey | LDVAKKHSVPWPLE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NNC(=S)N2CCC(=O)O |
Computed by PubChem (NCBI)