Products 1022155-94-7
CAS 1022155-94-7 appears in our catalog under these names: Methyl 2-(4-bromophenyl)-2,2-difluoroacetate, 95-<97%, Methyl 2-(4-bromophenyl)-2,2-difluoroacetate. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 5g, 10g, 25g, 50mg, 0,5g.
Methyl 2-(4-bromophenyl)-2,2-difluoroacetate (CAS 1022155-94-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-(4-bromophenyl)-2,2-difluoroacetate. InChIKey: NGBJVVVKPWOFIG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)-2,2-difluoroacetate |
| InChIKey | NGBJVVVKPWOFIG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Br)(F)F |
Computed by PubChem (NCBI)