Products 1023813-98-0

CAS 1023813-98-0 is the registry number for 2-((5-Chloropyrimidin-2-yl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(5-chloropyrimidin-2-yl)sulfanylacetic acid (CAS 1023813-98-0) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 2-(5-chloropyrimidin-2-yl)sulfanylacetic acid. InChIKey: OVPWHZMGKSVTOT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClN2O2S
Molecular weight204.63 g/mol
IUPAC name2-(5-chloropyrimidin-2-yl)sulfanylacetic acid
InChIKeyOVPWHZMGKSVTOT-UHFFFAOYSA-N
SMILESC1=C(C=NC(=N1)SCC(=O)O)Cl

Computed by PubChem (NCBI)