Products 884497-52-3
CAS 884497-52-3 appears in our catalog under these names: [(6-Chloropyrazin-2-yl)thio]acetic acid, 95%, 2-((6-Chloropyrazin-2-yl)thio)acetic acid, 95+%, 2-((6-Chloropyrazin-2-yl)thio)acetic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10mg, 50mg.
2-(6-chloropyrazin-2-yl)sulfanylacetic acid (CAS 884497-52-3) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 2-(6-chloropyrazin-2-yl)sulfanylacetic acid. InChIKey: YVZDYMPVZRGXHO-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 2-(6-chloropyrazin-2-yl)sulfanylacetic acid |
| InChIKey | YVZDYMPVZRGXHO-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C=N1)Cl)SCC(=O)O |
Computed by PubChem (NCBI)