CAS 409062-93-7 is the registry number for Imidazo(2,1-b)(1,3)thiazole-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
Imidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrochloride (CAS 409062-93-7) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: imidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrochloride. InChIKey: ZYOGNAZKOCMDNY-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | imidazo[2,1-b][1,3]thiazole-2-carboxylic acid;hydrochloride |
| InChIKey | ZYOGNAZKOCMDNY-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(SC2=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)