CAS 99951-95-8 appears in our catalog under these names: 6-Chloro-2-(methylthio)-4-pyrimidinecarboxylic Acid, 6-Chloro-2-(methylthio)pyrimidine-4-carboxylic acid 95%. Offered by: TRC, Biosynth, Ambeed. Available pack sizes: 500mg, 50mg, 0,5g, 100mg, 250mg, 1g.
6-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid (CAS 99951-95-8) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 6-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid. InChIKey: PELVWMMDKVPHOA-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 6-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid |
| InChIKey | PELVWMMDKVPHOA-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=CC(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)