CAS 2137605-31-1 appears in our catalog under these names: Imidazo(5,1-b)thiazole-3-carboxylic Acid Hydrochloride, Imidazo(4,3-b)(1,3)thiazole-3-carboxylic acid hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 0,5g, 50mg.
Imidazo[5,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride (CAS 2137605-31-1) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: imidazo[5,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride. InChIKey: OFKHNGSIRKOSAX-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | imidazo[5,1-b][1,3]thiazole-3-carboxylic acid;hydrochloride |
| InChIKey | OFKHNGSIRKOSAX-UHFFFAOYSA-N |
| SMILES | C1=C2N(C=N1)C(=CS2)C(=O)O.Cl |
Computed by PubChem (NCBI)