CAS 74840-34-9 appears in our catalog under these names: 4-Chloro-2-(methylthio)pyrimidine-5-carboxylic acid, 97%, 4–chloro–2–(methylthio)pyrimidine–5–carboxylic acid, 4-Chloro-2-(methylthio)pyrimidine-5-carboxylic acid 95% HPLC, 4-Chloro-2-(methylthio)pyrimidine-5-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
4-chloro-2-methylsulfanylpyrimidine-5-carboxylic acid (CAS 74840-34-9) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 4-chloro-2-methylsulfanylpyrimidine-5-carboxylic acid. InChIKey: MYNMNRVNVCHWIT-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanylpyrimidine-5-carboxylic acid |
| InChIKey | MYNMNRVNVCHWIT-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C(C(=N1)Cl)C(=O)O |
Computed by PubChem (NCBI)