CAS 61727-33-1 appears in our catalog under these names: 5–Chloro–2–(methylthio)pyrimidine–4–carboxylic acid, 5-Chloro-2-(methylthio)pyrimidine-4-carboxylic Acid, >97.0%(GC)(T), 5-Chloro-2-(methylthio)pyrimidine-4-carboxylic acid, 97% , 5-Chloro-2-(methylthio)pyrimidine-4-carboxylic acid 98%, 5-Chloro-2-(methylthio)pyrimidine-4-carboxylic Acid, 98%, 98%. Offered by: GLPBio, TCI, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
5-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid (CAS 61727-33-1) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 5-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid. InChIKey: SEPCYCDQJZTPHO-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2S |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 5-chloro-2-methylsulfanylpyrimidine-4-carboxylic acid |
| InChIKey | SEPCYCDQJZTPHO-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C(C(=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)