Products 1198306-44-3

CAS 1198306-44-3 is the registry number for 2-Chloro-4-(methylthio)pyrimidine-5-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-methylsulfanylpyrimidine-5-carboxylic acid (CAS 1198306-44-3) is a chemical compound with the molecular formula C6H5ClN2O2S and a molecular weight of 204.63 g/mol. IUPAC name: 2-chloro-4-methylsulfanylpyrimidine-5-carboxylic acid. InChIKey: SISWCDGSFQYXKC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClN2O2S
Molecular weight204.63 g/mol
IUPAC name2-chloro-4-methylsulfanylpyrimidine-5-carboxylic acid
InChIKeySISWCDGSFQYXKC-UHFFFAOYSA-N
SMILESCSC1=NC(=NC=C1C(=O)O)Cl

Computed by PubChem (NCBI)