Products 1024127-44-3
CAS 1024127-44-3 is the registry number for N-(2-hydroxy-5-nitrophenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-hydroxy-5-nitrophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1024127-44-3) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: N-(2-hydroxy-5-nitrophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: HGOCLSFPWBGFBU-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | N-(2-hydroxy-5-nitrophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | HGOCLSFPWBGFBU-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=C(C=CC(=C3)[N+](=O)[O-])O |
Computed by PubChem (NCBI)