CAS 503598-07-0 appears in our catalog under these names: Imidafenacin Impurity 6, Imidafenacin Impurity 3, Imidafenacin Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid (CAS 503598-07-0) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: 2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid. InChIKey: YNGURMKOKFOQOX-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid |
| InChIKey | YNGURMKOKFOQOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCNC(=O)C(=O)O)(C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)