Products 503598-07-0

CAS 503598-07-0 appears in our catalog under these names: Imidafenacin Impurity 6, Imidafenacin Impurity 3, Imidafenacin Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid (CAS 503598-07-0) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: 2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid. InChIKey: YNGURMKOKFOQOX-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O4
Molecular weight326.3 g/mol
IUPAC name2-[(4-amino-4-oxo-3,3-diphenylbutyl)amino]-2-oxoacetic acid
InChIKeyYNGURMKOKFOQOX-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CCNC(=O)C(=O)O)(C2=CC=CC=C2)C(=O)N

Computed by PubChem (NCBI)