CAS 10242-11-2 appears in our catalog under these names: 5–bromo–1–benzofuran–2–carboxylicacid, 5-Bromobenzofuran-2-carboxylic acid 96%, 5-Bromobenzofuran-2-carboxylic acid, 96%, 96%, 5-Bromo-1-benzofuran-2-carboxylic acid, 97% , 5-Bromo-1-benzofuran-2-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 10g, 100g.
5-bromo-1-benzofuran-2-carboxylic acid (CAS 10242-11-2) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1-benzofuran-2-carboxylic acid. InChIKey: QKUWZCOVKRUXKX-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1-benzofuran-2-carboxylic acid |
| InChIKey | QKUWZCOVKRUXKX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)