CAS 552333-33-2 appears in our catalog under these names: 7-Bromo-1h-isochromene-1,3(4H)-dione, 95%, 7–BROMO–1H–ISOCHROMENE–1,3(4H)–DIONE. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g.
7-bromo-4H-isochromene-1,3-dione (CAS 552333-33-2) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-4H-isochromene-1,3-dione. InChIKey: WANGWCBXVJULNK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-4H-isochromene-1,3-dione |
| InChIKey | WANGWCBXVJULNK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Br)C(=O)OC1=O |
Computed by PubChem (NCBI)