Products 1374574-88-5
CAS 1374574-88-5 appears in our catalog under these names: 7-Bromobenzofuran-3-carboxylic acid, 95%, 7-Bromo-1-benzofuran-3-carboxylic acid, 7-Bromobenzofuran-3-carboxylic acid 97%, 7-Bromo-1-benzofuran-3-carboxylic acid, 96%, 96%, 7-BROMOBENZOFURAN-3-CARBOXYLIC ACID, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 5g, 500mg, 2.5g.
7-bromo-1-benzofuran-3-carboxylic acid (CAS 1374574-88-5) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-1-benzofuran-3-carboxylic acid. InChIKey: IJEZISLPHXSBTK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-1-benzofuran-3-carboxylic acid |
| InChIKey | IJEZISLPHXSBTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC=C2C(=O)O |
Computed by PubChem (NCBI)