CAS 461663-79-6 appears in our catalog under these names: 5-Bromobenzofuran-3-carboxylic acid, 97%, 5-Bromo-1-benzofuran-3-carboxylic acid, 5-Bromobenzofuran-3-carboxylic Acid, 97%, 97%, 5-Bromo-1-benzofuran-3-carboxylic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 2,5g, 250mg, 50mg, 100mg, 500mg, 1g, 2.5g.
5-bromo-1-benzofuran-3-carboxylic acid (CAS 461663-79-6) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-1-benzofuran-3-carboxylic acid. InChIKey: MZQBOTQXGIKNEO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-1-benzofuran-3-carboxylic acid |
| InChIKey | MZQBOTQXGIKNEO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)