CAS 1260387-31-2 is the registry number for 5-Bromoisochromane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4H-isochromene-1,3-dione (CAS 1260387-31-2) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 5-bromo-4H-isochromene-1,3-dione. InChIKey: IBQJPLCCKKMQHW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-bromo-4H-isochromene-1,3-dione |
| InChIKey | IBQJPLCCKKMQHW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2Br)C(=O)OC1=O |
Computed by PubChem (NCBI)