CAS 286836-25-7 appears in our catalog under these names: 7-Bromobenzofuran-5-carboxylic acid, 98+%, 7-Bromo-5-benzofurancarboxylic acid, 97%, 97%, 7-Bromo-1-benzofuran-5-carboxylic acid, 95%, 7-Bromo-1-benzofuran-5-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg.
7-bromo-1-benzofuran-5-carboxylic acid (CAS 286836-25-7) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-1-benzofuran-5-carboxylic acid. InChIKey: VRGGTOQHOVHAEU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-1-benzofuran-5-carboxylic acid |
| InChIKey | VRGGTOQHOVHAEU-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C=C(C=C21)C(=O)O)Br |
Computed by PubChem (NCBI)