Products 1369143-28-1
CAS 1369143-28-1 appears in our catalog under these names: 4-bromo-1-benzofuran-2-carboxylic acid, 4-Bromo-1-benzofuran-2-carboxylic acid, 96%, 4–Bromobenzofuran–2–carboxylic acid, 4-Bromobenzofuran-2-carboxylic acid 98%, 4-Bromo-1-benzofuran-2-carboxylic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 10g, 250mg, 5g, 25g, 100mg.
4-bromo-1-benzofuran-2-carboxylic acid (CAS 1369143-28-1) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 4-bromo-1-benzofuran-2-carboxylic acid. InChIKey: AWHJIEGQJDBVCF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 4-bromo-1-benzofuran-2-carboxylic acid |
| InChIKey | AWHJIEGQJDBVCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(O2)C(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)