CAS 1070292-82-8 is the registry number for 6-Bromoisochromane-1,3-dione, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
6-bromo-4H-isochromene-1,3-dione (CAS 1070292-82-8) is a chemical compound with the molecular formula C9H5BrO3 and a molecular weight of 241.04 g/mol. IUPAC name: 6-bromo-4H-isochromene-1,3-dione. InChIKey: ALIXFQVQRAXYSL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO3 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 6-bromo-4H-isochromene-1,3-dione |
| InChIKey | ALIXFQVQRAXYSL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)OC1=O |
Computed by PubChem (NCBI)