CAS 1024597-83-8 is the registry number for Methyl 2,3,6-trichloro-4-pyridinecarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
Methyl 2,3,6-trichloropyridine-4-carboxylate (CAS 1024597-83-8) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 2,3,6-trichloropyridine-4-carboxylate. InChIKey: DXVOAKSOBBPZNA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 2,3,6-trichloropyridine-4-carboxylate |
| InChIKey | DXVOAKSOBBPZNA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)