Products 22548-85-2
CAS 22548-85-2 is the registry number for 1,3,4-Trichloro-2-methyl-5-nitrobenzene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,4-trichloro-2-methyl-5-nitrobenzene (CAS 22548-85-2) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: 1,3,4-trichloro-2-methyl-5-nitrobenzene. InChIKey: OZTVOUBBPNUZDA-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 1,3,4-trichloro-2-methyl-5-nitrobenzene |
| InChIKey | OZTVOUBBPNUZDA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)