CAS 192124-88-2 is the registry number for 2,3-Dichloro-6-nitrobenzyl Chloride. Offered by: TRC. Available pack sizes: 5g.
1,2-dichloro-3-(chloromethyl)-4-nitrobenzene (CAS 192124-88-2) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: 1,2-dichloro-3-(chloromethyl)-4-nitrobenzene. InChIKey: ZELSTMZJPQYYOB-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 1,2-dichloro-3-(chloromethyl)-4-nitrobenzene |
| InChIKey | ZELSTMZJPQYYOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CCl)Cl)Cl |
Computed by PubChem (NCBI)