CAS 294876-53-2 is the registry number for 2,5,6-Trichloro-4-methylnicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,5,6-trichloro-4-methylpyridine-3-carboxylic acid (CAS 294876-53-2) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: 2,5,6-trichloro-4-methylpyridine-3-carboxylic acid. InChIKey: SSKQQYTWGFOTOY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2,5,6-trichloro-4-methylpyridine-3-carboxylic acid |
| InChIKey | SSKQQYTWGFOTOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=C1Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)