Products 294876-53-2

CAS 294876-53-2 is the registry number for 2,5,6-Trichloro-4-methylnicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2,5,6-trichloro-4-methylpyridine-3-carboxylic acid (CAS 294876-53-2) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: 2,5,6-trichloro-4-methylpyridine-3-carboxylic acid. InChIKey: SSKQQYTWGFOTOY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Cl3NO2
Molecular weight240.5 g/mol
IUPAC name2,5,6-trichloro-4-methylpyridine-3-carboxylic acid
InChIKeySSKQQYTWGFOTOY-UHFFFAOYSA-N
SMILESCC1=C(C(=NC(=C1Cl)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)