CAS 350602-02-7 is the registry number for Methyl 3,4,6-trichloropicolinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,4,6-trichloropyridine-2-carboxylate (CAS 350602-02-7) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 3,4,6-trichloropyridine-2-carboxylate. InChIKey: YKFPEXSWHBLGDK-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 3,4,6-trichloropyridine-2-carboxylate |
| InChIKey | YKFPEXSWHBLGDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)