Products 350602-02-7

CAS 350602-02-7 is the registry number for Methyl 3,4,6-trichloropicolinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3,4,6-trichloropyridine-2-carboxylate (CAS 350602-02-7) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 3,4,6-trichloropyridine-2-carboxylate. InChIKey: YKFPEXSWHBLGDK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4Cl3NO2
Molecular weight240.5 g/mol
IUPAC namemethyl 3,4,6-trichloropyridine-2-carboxylate
InChIKeyYKFPEXSWHBLGDK-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC(=N1)Cl)Cl)Cl

Computed by PubChem (NCBI)