Products 1360894-25-2
CAS 1360894-25-2 is the registry number for Methyl 3,5,6-Trichloropicolinate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3,5,6-trichloropyridine-2-carboxylate (CAS 1360894-25-2) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 3,5,6-trichloropyridine-2-carboxylate. InChIKey: QEAIPSWIKISPLT-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 3,5,6-trichloropyridine-2-carboxylate |
| InChIKey | QEAIPSWIKISPLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)