CAS 1221791-65-6 appears in our catalog under these names: Methyl 2,3,5-trichloroisonicotinate 95%, Methyl 2,3,5-trichloroisonicotinate, 95%, 95%, METHYL 2,3,5-TRICHLOROISONICOTINATE, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,3,5-trichloropyridine-4-carboxylate (CAS 1221791-65-6) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 2,3,5-trichloropyridine-4-carboxylate. InChIKey: CRSDEIIJMVDXIW-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 2,3,5-trichloropyridine-4-carboxylate |
| InChIKey | CRSDEIIJMVDXIW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)