CAS 1218994-35-4 appears in our catalog under these names: Methyl 2,4,6-trichloronicotinate, 95+%, Methyl 2,4,6-trichloronicotinate, 98%, 98%, METHYL 2,4,6-TRICHLORONICOTINATE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 2,4,6-trichloropyridine-3-carboxylate (CAS 1218994-35-4) is a chemical compound with the molecular formula C7H4Cl3NO2 and a molecular weight of 240.5 g/mol. IUPAC name: methyl 2,4,6-trichloropyridine-3-carboxylate. InChIKey: RRAISDXHCRPYTQ-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl3NO2 |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 2,4,6-trichloropyridine-3-carboxylate |
| InChIKey | RRAISDXHCRPYTQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)