Products 1025127-35-8

CAS 1025127-35-8 is the registry number for 5-Amino-2,4-difluoro-3-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-amino-2,4-difluoro-3-hydroxybenzoic acid (CAS 1025127-35-8) is a chemical compound with the molecular formula C7H5F2NO3 and a molecular weight of 189.12 g/mol. IUPAC name: 5-amino-2,4-difluoro-3-hydroxybenzoic acid. InChIKey: RQIRQOCTOBXYQC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F2NO3
Molecular weight189.12 g/mol
IUPAC name5-amino-2,4-difluoro-3-hydroxybenzoic acid
InChIKeyRQIRQOCTOBXYQC-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=C1N)F)O)F)C(=O)O

Computed by PubChem (NCBI)