CAS 1025997-07-2 is the registry number for ((benzo(3,4-d)1,3-dioxolan-5-ylamino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(1,3-benzodioxol-5-ylamino)methylidene]propanedinitrile (CAS 1025997-07-2) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 2-[(1,3-benzodioxol-5-ylamino)methylidene]propanedinitrile. InChIKey: LIJZBQKEPPDFMN-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-[(1,3-benzodioxol-5-ylamino)methylidene]propanedinitrile |
| InChIKey | LIJZBQKEPPDFMN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC=C(C#N)C#N |
Computed by PubChem (NCBI)