CAS 240802-59-9 appears in our catalog under these names: 2-((6-Oxo-1,6-dihydropyrimidin-4-yl)oxy)benzonitrile, 97%, Azoxystrobin metabolite R401553, R401553, Azoxystrobin Metabolite R401553, Concentration: 10.0 µg/ml Solvent: Acetonitrile. Offered by: AmBeed, Dr. Ehrenstorfer, TRC, HPC Standards. Available pack sizes: 1g, 10mg, 100mg, 1x10mg, 1x10ml.
2-[(6-oxo-1H-pyrimidin-4-yl)oxy]benzonitrile (CAS 240802-59-9) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 2-[(6-oxo-1H-pyrimidin-4-yl)oxy]benzonitrile. InChIKey: AEPJWPTWMHUKLG-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-[(6-oxo-1H-pyrimidin-4-yl)oxy]benzonitrile |
| InChIKey | AEPJWPTWMHUKLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC2=CC(=O)NC=N2 |
Computed by PubChem (NCBI)