Products 1452838-22-0
CAS 1452838-22-0 is the registry number for 3-((1E)-2-Nitroethenyl)-1H-indole-5-carbonitrile. Offered by: TRC. Available pack sizes: 750mg.
3-[(E)-2-nitroethenyl]-1H-indole-5-carbonitrile (CAS 1452838-22-0) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 3-[(E)-2-nitroethenyl]-1H-indole-5-carbonitrile. InChIKey: CQDDYYRKWJNSCZ-ONEGZZNKSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-[(E)-2-nitroethenyl]-1H-indole-5-carbonitrile |
| InChIKey | CQDDYYRKWJNSCZ-ONEGZZNKSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)