CAS 15832-30-1 is the registry number for 3-Phenylisoxazolo[5,4-d]pyrimidin-4(5H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenyl-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one (CAS 15832-30-1) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 3-phenyl-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one. InChIKey: VDZPDZOUXAGXOV-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-phenyl-5H-[1,2]oxazolo[5,4-d]pyrimidin-4-one |
| InChIKey | VDZPDZOUXAGXOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)