CAS 176853-91-1 is the registry number for 2-Nitro-9H-pyrido(2,3-b)indole. Offered by: TRC. Available pack sizes: 100mg.
2-nitro-9H-pyrido[2,3-b]indole (CAS 176853-91-1) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 2-nitro-9H-pyrido[2,3-b]indole. InChIKey: MZRPARBJFRBBRX-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-nitro-9H-pyrido[2,3-b]indole |
| InChIKey | MZRPARBJFRBBRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)