CAS 72159-22-9 is the registry number for 2-(1H-Pyrazol-3-yl)-1H-isoindole-1,3(2H)-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(1H-pyrazol-5-yl)isoindole-1,3-dione (CAS 72159-22-9) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(1H-pyrazol-5-yl)isoindole-1,3-dione. InChIKey: TXJMOUZMFKYCOY-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(1H-pyrazol-5-yl)isoindole-1,3-dione |
| InChIKey | TXJMOUZMFKYCOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=NN3 |
Computed by PubChem (NCBI)