Products 811841-69-7
CAS 811841-69-7 appears in our catalog under these names: 2-((2,2-Dinitrilovinyl)amino)benzoic acid, 95%, 2-((2,2-Dinitrilovinyl)amino)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 25g.
2-(2,2-dicyanoethenylamino)benzoic acid (CAS 811841-69-7) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(2,2-dicyanoethenylamino)benzoic acid. InChIKey: XQLSFKXOYYUDOY-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(2,2-dicyanoethenylamino)benzoic acid |
| InChIKey | XQLSFKXOYYUDOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC=C(C#N)C#N |
Computed by PubChem (NCBI)
Synonyms:
2-((2,2-Dinitrilovinyl)amino)benzoic acid, 2-(2,2-dicyanoethenylamino)benzoic Acid, 2-[(2,2-dicyanoeth-1-en-1-yl)amino]benzoic acid, 2-[(2,2-dicyanovinyl)amino]benzenecarboxylic acid, 2-((2,2-Dicyanovinyl)amino)benzoic acid, 2-[(2,2-dicyanovinyl)amino]benzoic acid, 2-(2,2-dicyanovinylamino)benzoic acid, 2-[(2,2-dicyanoeth-1-en-1-yl)amino]benzoicacid