CAS 76002-75-0 is the registry number for Imidazo[1,2-a]quinoxaline-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Imidazo[1,2-a]quinoxaline-2-carboxylic acid (CAS 76002-75-0) is a chemical compound with the molecular formula C11H7N3O2 and a molecular weight of 213.19 g/mol. IUPAC name: imidazo[1,2-a]quinoxaline-2-carboxylic acid. InChIKey: JVKYTWZLUFMIKS-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O2 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | imidazo[1,2-a]quinoxaline-2-carboxylic acid |
| InChIKey | JVKYTWZLUFMIKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC3=NC(=CN23)C(=O)O |
Computed by PubChem (NCBI)