CAS 1027775-18-3 appears in our catalog under these names: 4,7,8-Trichloroquinazoline, 95%, 4,7,8-Trichloroquinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4,7,8-trichloroquinazoline (CAS 1027775-18-3) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 4,7,8-trichloroquinazoline. InChIKey: HVUDQSHQMHCEQV-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 4,7,8-trichloroquinazoline |
| InChIKey | HVUDQSHQMHCEQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=NC=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)