CAS 1313738-65-6 is the registry number for 3,4,8-Trichloro-1,7-naphthyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3,4,8-trichloro-1,7-naphthyridine (CAS 1313738-65-6) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 3,4,8-trichloro-1,7-naphthyridine. InChIKey: QNHPZTLZDZFQAO-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 3,4,8-trichloro-1,7-naphthyridine |
| InChIKey | QNHPZTLZDZFQAO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=NC=C(C(=C21)Cl)Cl)Cl |
Computed by PubChem (NCBI)