CAS 178309-37-0 appears in our catalog under these names: 1,4,6-Trichlorophthalazine, 98%, 1,4,6-Trichlorophthalazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
1,4,6-trichlorophthalazine (CAS 178309-37-0) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 1,4,6-trichlorophthalazine. InChIKey: UHLIWROXGHZFPB-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 1,4,6-trichlorophthalazine |
| InChIKey | UHLIWROXGHZFPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)