CAS 57940-05-3 appears in our catalog under these names: 4,6,7-Trichloroquinazoline, 95%, 4,6,7-Trichloroquinazoline 95+%, 4,6,7-Trichloroquinazoline, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
4,6,7-trichloroquinazoline (CAS 57940-05-3) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 4,6,7-trichloroquinazoline. InChIKey: JHLMAVSDZYYXFQ-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 4,6,7-trichloroquinazoline |
| InChIKey | JHLMAVSDZYYXFQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)