CAS 2958-87-4 appears in our catalog under these names: 2,3,6-Trichloroquinoxaline, 98%, 2,3,6–Trichloroquinoxaline, 2,3,6-Trichloroquinoxaline, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
2,3,6-trichloroquinoxaline (CAS 2958-87-4) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 2,3,6-trichloroquinoxaline. InChIKey: GZEGFNCRZUGIOB-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 2,3,6-trichloroquinoxaline |
| InChIKey | GZEGFNCRZUGIOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)