CAS 931100-02-6 appears in our catalog under these names: 4,6,8-Trichloro-1,7-naphthyridine, 98%, 4,6,8-Trichloro-1,7-naphthyridine, 97%, 97%, 4,6,8-Trichloro-1,7-naphthyridine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 500mg.
4,6,8-trichloro-1,7-naphthyridine (CAS 931100-02-6) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 4,6,8-trichloro-1,7-naphthyridine. InChIKey: RXWXAIRRMCXMBL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 4,6,8-trichloro-1,7-naphthyridine |
| InChIKey | RXWXAIRRMCXMBL-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)