CAS 67092-22-2 is the registry number for 2,5,8-Trichloroquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5,8-trichloroquinazoline (CAS 67092-22-2) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 2,5,8-trichloroquinazoline. InChIKey: OSFONGKOKDAYAC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 2,5,8-trichloroquinazoline |
| InChIKey | OSFONGKOKDAYAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)