CAS 1442474-78-3 is the registry number for 1,4,5-Trichlorophthalazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4,5-trichlorophthalazine (CAS 1442474-78-3) is a chemical compound with the molecular formula C8H3Cl3N2 and a molecular weight of 233.5 g/mol. IUPAC name: 1,4,5-trichlorophthalazine. InChIKey: SOBLIWGRZLMZKV-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl3N2 |
|---|---|
| Molecular weight | 233.5 g/mol |
| IUPAC name | 1,4,5-trichlorophthalazine |
| InChIKey | SOBLIWGRZLMZKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)