CAS 1028843-12-0 is the registry number for 3-(2,6-Dichlorophenyl)-1H-pyrazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,6-dichlorophenyl)-1H-pyrazol-3-amine (CAS 1028843-12-0) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 5-(2,6-dichlorophenyl)-1H-pyrazol-3-amine. InChIKey: YQTCSCZOJRTOTJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 5-(2,6-dichlorophenyl)-1H-pyrazol-3-amine |
| InChIKey | YQTCSCZOJRTOTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=CC(=NN2)N)Cl |
Computed by PubChem (NCBI)